C21H18N2O6S — CID 135948581
2-[[(5Z)-5-[[3-(2-carboxyethoxy)phenyl]methylidene]-4-oxo-1,3-thiazolidin-2-ylidene]amino]-4-methylbenzoic acid (PubChem CID 135948581) has the molecular formula C21H18N2O6S and a molecular weight of 426.45 g/mol. Its IUPAC name is 2-[[(5Z)-5-[[3-(2-carboxyethoxy)phenyl]methylidene]-4-oxo-1,3-thiazolidin-2-ylidene]amino]-4-methylbenzoic acid.
| Compound Name | 2-[[(5Z)-5-[[3-(2-carboxyethoxy)phenyl]methylidene]-4-oxo-1,3-thiazolidin-2-ylidene]amino]-4-methylbenzoic acid |
|---|---|
| PubChem CID | 135948581 |
| Molecular Formula | C21H18N2O6S |
| Molecular Weight | 426.45 g/mol |
| Exact Mass | 426.09 |
| IUPAC Name | 2-[[(5Z)-5-[[3-(2-carboxyethoxy)phenyl]methylidene]-4-oxo-1,3-thiazolidin-2-ylidene]amino]-4-methylbenzoic acid |
| SMILES | Cc1ccc(C(=O)O)c(/N=C2\NC(=O)/C(=C/c3cccc(OCCC(=O)O)c3)S2)c1 |
| InChI | InChI=1S/C21H18N2O6S/c1-12-5-6-15(20(27)28)16(9-12)22-21-23-19(26)17(30-21)11-13-3-2-4-14(10-13)29-8-7-18(24)25/h2-6,9-11H,7-8H2,1H3,(H,24,25)(H,27,28)(H,22,23,26)/b17-11- |
| InChIKey | OKLMCSGXHPMAFJ-BOPFTXTBSA-N |
| XLogP | 3.44 |
| TPSA | 125.29 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.45 |
| LogP ≤ 5 | 3.44 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|