C28H31FN4O — CID 135951085
N-[N-(3,5-dimethylphenyl)-C-[4-[(2-fluorophenyl)methyl]piperazin-1-yl]carbonimidoyl]-3-methylbenzamide (PubChem CID 135951085) has the molecular formula C28H31FN4O and a molecular weight of 458.58 g/mol. Its IUPAC name is N-[N-(3,5-dimethylphenyl)-C-[4-[(2-fluorophenyl)methyl]piperazin-1-yl]carbonimidoyl]-3-methylbenzamide.
| Compound Name | N-[N-(3,5-dimethylphenyl)-C-[4-[(2-fluorophenyl)methyl]piperazin-1-yl]carbonimidoyl]-3-methylbenzamide |
|---|---|
| PubChem CID | 135951085 |
| Molecular Formula | C28H31FN4O |
| Molecular Weight | 458.58 g/mol |
| Exact Mass | 458.25 |
| IUPAC Name | N-[N-(3,5-dimethylphenyl)-C-[4-[(2-fluorophenyl)methyl]piperazin-1-yl]carbonimidoyl]-3-methylbenzamide |
| SMILES | Cc1cc(C)cc(/N=C(\NC(=O)c2cccc(C)c2)N2CCN(Cc3ccccc3F)CC2)c1 |
| InChI | InChI=1S/C28H31FN4O/c1-20-7-6-9-23(16-20)27(34)31-28(30-25-17-21(2)15-22(3)18-25)33-13-11-32(12-14-33)19-24-8-4-5-10-26(24)29/h4-10,15-18H,11-14,19H2,1-3H3,(H,30,31,34) |
| InChIKey | KGRVYCOCXYAIRI-UHFFFAOYSA-N |
| XLogP | 4.99 |
| TPSA | 47.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.58 |
| LogP ≤ 5 | 4.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|