C42H38N4O2 — CID 135961661
4-tert-butyl-2-[9-(5-tert-butyl-2-hydroxy-3-pyridin-2-ylphenyl)-1,10-phenanthrolin-2-yl]-6-pyridin-2-ylphenol (PubChem CID 135961661) has the molecular formula C42H38N4O2 and a molecular weight of 630.79 g/mol. Its IUPAC name is 4-tert-butyl-2-[9-(5-tert-butyl-2-hydroxy-3-pyridin-2-ylphenyl)-1,10-phenanthrolin-2-yl]-6-pyridin-2-ylphenol.
| Compound Name | 4-tert-butyl-2-[9-(5-tert-butyl-2-hydroxy-3-pyridin-2-ylphenyl)-1,10-phenanthrolin-2-yl]-6-pyridin-2-ylphenol |
|---|---|
| PubChem CID | 135961661 |
| Molecular Formula | C42H38N4O2 |
| Molecular Weight | 630.79 g/mol |
| Exact Mass | 630.30 |
| IUPAC Name | 4-tert-butyl-2-[9-(5-tert-butyl-2-hydroxy-3-pyridin-2-ylphenyl)-1,10-phenanthrolin-2-yl]-6-pyridin-2-ylphenol |
| SMILES | CC(C)(C)c1cc(-c2ccccn2)c(O)c(-c2ccc3ccc4ccc(-c5cc(C(C)(C)C)cc(-c6ccccn6)c5O)nc4c3n2)c1 |
| InChI | InChI=1S/C42H38N4O2/c1-41(2,3)27-21-29(33-11-7-9-19-43-33)39(47)31(23-27)35-17-15-25-13-14-26-16-18-36(46-38(26)37(25)45-35)32-24-28(42(4,5)6)22-30(40(32)48)34-12-8-10-20-44-34/h7-24,47-48H,1-6H3 |
| InChIKey | UCUNCEHETYSVSW-UHFFFAOYSA-N |
| XLogP | 10.25 |
| TPSA | 92.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 630.79 |
| LogP ≤ 5 | 10.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|