C41H38N4O2 — CID 140549434
4-tert-butyl-2-[9-(5-tert-butyl-2-hydroxy-3-pyridin-2-ylphenyl)-1,10-phenanthrolin-2-yl]-6-(1H-pyrrol-2-yl)phenol (PubChem CID 140549434) has the molecular formula C41H38N4O2 and a molecular weight of 618.78 g/mol. Its IUPAC name is 4-tert-butyl-2-[9-(5-tert-butyl-2-hydroxy-3-pyridin-2-ylphenyl)-1,10-phenanthrolin-2-yl]-6-(1H-pyrrol-2-yl)phenol.
| Compound Name | 4-tert-butyl-2-[9-(5-tert-butyl-2-hydroxy-3-pyridin-2-ylphenyl)-1,10-phenanthrolin-2-yl]-6-(1H-pyrrol-2-yl)phenol |
|---|---|
| PubChem CID | 140549434 |
| Molecular Formula | C41H38N4O2 |
| Molecular Weight | 618.78 g/mol |
| Exact Mass | 618.30 |
| IUPAC Name | 4-tert-butyl-2-[9-(5-tert-butyl-2-hydroxy-3-pyridin-2-ylphenyl)-1,10-phenanthrolin-2-yl]-6-(1H-pyrrol-2-yl)phenol |
| SMILES | CC(C)(C)c1cc(-c2ccccn2)c(O)c(-c2ccc3ccc4ccc(-c5cc(C(C)(C)C)cc(-c6ccc[nH]6)c5O)nc4c3n2)c1 |
| InChI | InChI=1S/C41H38N4O2/c1-40(2,3)26-20-28(32-10-7-8-18-42-32)38(46)30(22-26)34-16-14-24-12-13-25-15-17-35(45-37(25)36(24)44-34)31-23-27(41(4,5)6)21-29(39(31)47)33-11-9-19-43-33/h7-23,43,46-47H,1-6H3 |
| InChIKey | ZHIDUVYRFDLXSI-UHFFFAOYSA-N |
| XLogP | 10.18 |
| TPSA | 94.92 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 618.78 |
| LogP ≤ 5 | 10.18 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|