C40H36N2OS2 — CID 145474627
4-tert-butyl-2-[9-(3-tert-butyl-5-thiophen-2-ylphenyl)-1,10-phenanthrolin-2-yl]-6-thiophen-2-ylphenol (PubChem CID 145474627) has the molecular formula C40H36N2OS2 and a molecular weight of 624.88 g/mol. Its IUPAC name is 4-tert-butyl-2-[9-(3-tert-butyl-5-thiophen-2-ylphenyl)-1,10-phenanthrolin-2-yl]-6-thiophen-2-ylphenol.
| Compound Name | 4-tert-butyl-2-[9-(3-tert-butyl-5-thiophen-2-ylphenyl)-1,10-phenanthrolin-2-yl]-6-thiophen-2-ylphenol |
|---|---|
| PubChem CID | 145474627 |
| Molecular Formula | C40H36N2OS2 |
| Molecular Weight | 624.88 g/mol |
| Exact Mass | 624.23 |
| IUPAC Name | 4-tert-butyl-2-[9-(3-tert-butyl-5-thiophen-2-ylphenyl)-1,10-phenanthrolin-2-yl]-6-thiophen-2-ylphenol |
| SMILES | CC(C)(C)c1cc(-c2ccc3ccc4ccc(-c5cc(C(C)(C)C)cc(-c6cccs6)c5O)nc4c3n2)cc(-c2cccs2)c1 |
| InChI | InChI=1S/C40H36N2OS2/c1-39(2,3)28-20-26(19-27(21-28)34-9-7-17-44-34)32-15-13-24-11-12-25-14-16-33(42-37(25)36(24)41-32)30-22-29(40(4,5)6)23-31(38(30)43)35-10-8-18-45-35/h7-23,43H,1-6H3 |
| InChIKey | MTCNKPASFBKSHR-UHFFFAOYSA-N |
| XLogP | 11.87 |
| TPSA | 46.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 624.88 |
| LogP ≤ 5 | 11.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|