C17H21F3N6OS — CID 135963574
[(5R,7R)-5-ethyl-7-(trifluoromethyl)-4,5,6,7-tetrahydropyrazolo[1,5-a]pyrimidin-2-yl]-[4-(1,3-thiazol-2-yl)piperazin-1-yl]methanone (PubChem CID 135963574) has the molecular formula C17H21F3N6OS and a molecular weight of 414.46 g/mol. Its IUPAC name is [(5R,7R)-5-ethyl-7-(trifluoromethyl)-4,5,6,7-tetrahydropyrazolo[1,5-a]pyrimidin-2-yl]-[4-(1,3-thiazol-2-yl)piperazin-1-yl]methanone.
| Compound Name | [(5R,7R)-5-ethyl-7-(trifluoromethyl)-4,5,6,7-tetrahydropyrazolo[1,5-a]pyrimidin-2-yl]-[4-(1,3-thiazol-2-yl)piperazin-1-yl]methanone |
|---|---|
| PubChem CID | 135963574 |
| Molecular Formula | C17H21F3N6OS |
| Molecular Weight | 414.46 g/mol |
| Exact Mass | 414.14 |
| IUPAC Name | [(5R,7R)-5-ethyl-7-(trifluoromethyl)-4,5,6,7-tetrahydropyrazolo[1,5-a]pyrimidin-2-yl]-[4-(1,3-thiazol-2-yl)piperazin-1-yl]methanone |
| SMILES | CC[C@@H]1C[C@H](C(F)(F)F)n2nc(C(=O)N3CCN(c4nccs4)CC3)cc2N1 |
| InChI | InChI=1S/C17H21F3N6OS/c1-2-11-9-13(17(18,19)20)26-14(22-11)10-12(23-26)15(27)24-4-6-25(7-5-24)16-21-3-8-28-16/h3,8,10-11,13,22H,2,4-7,9H2,1H3/t11-,13-/m1/s1 |
| InChIKey | XYYYRCLLAICMLS-DGCLKSJQSA-N |
| XLogP | 3.00 |
| TPSA | 66.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.46 |
| LogP ≤ 5 | 3.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |