C15H10Br2F3NOS — CID 135964648
2,4-dibromo-6-hydroxy-N-[[4-(trifluoromethyl)phenyl]methyl]benzenecarbothioamide (PubChem CID 135964648) has the molecular formula C15H10Br2F3NOS and a molecular weight of 469.12 g/mol. Its IUPAC name is 2,4-dibromo-6-hydroxy-N-[[4-(trifluoromethyl)phenyl]methyl]benzenecarbothioamide.
| Compound Name | 2,4-dibromo-6-hydroxy-N-[[4-(trifluoromethyl)phenyl]methyl]benzenecarbothioamide |
|---|---|
| PubChem CID | 135964648 |
| Molecular Formula | C15H10Br2F3NOS |
| Molecular Weight | 469.12 g/mol |
| Exact Mass | 466.88 |
| IUPAC Name | 2,4-dibromo-6-hydroxy-N-[[4-(trifluoromethyl)phenyl]methyl]benzenecarbothioamide |
| SMILES | Oc1cc(Br)cc(Br)c1C(=S)NCc1ccc(C(F)(F)F)cc1 |
| InChI | InChI=1S/C15H10Br2F3NOS/c16-10-5-11(17)13(12(22)6-10)14(23)21-7-8-1-3-9(4-2-8)15(18,19)20/h1-6,22H,7H2,(H,21,23) |
| InChIKey | RBDLRJOALNAAKS-UHFFFAOYSA-N |
| XLogP | 5.40 |
| TPSA | 32.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 469.12 |
| LogP ≤ 5 | 5.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|