C19H20F3NS — CID 14772560
2,6-diethyl-N-[[4-(trifluoromethyl)phenyl]methyl]benzenecarbothioamide (PubChem CID 14772560) has the molecular formula C19H20F3NS and a molecular weight of 351.44 g/mol. Its IUPAC name is 2,6-diethyl-N-[[4-(trifluoromethyl)phenyl]methyl]benzenecarbothioamide.
| Compound Name | 2,6-diethyl-N-[[4-(trifluoromethyl)phenyl]methyl]benzenecarbothioamide |
|---|---|
| PubChem CID | 14772560 |
| Molecular Formula | C19H20F3NS |
| Molecular Weight | 351.44 g/mol |
| Exact Mass | 351.13 |
| IUPAC Name | 2,6-diethyl-N-[[4-(trifluoromethyl)phenyl]methyl]benzenecarbothioamide |
| SMILES | CCc1cccc(CC)c1C(=S)NCc1ccc(C(F)(F)F)cc1 |
| InChI | InChI=1S/C19H20F3NS/c1-3-14-6-5-7-15(4-2)17(14)18(24)23-12-13-8-10-16(11-9-13)19(20,21)22/h5-11H,3-4,12H2,1-2H3,(H,23,24) |
| InChIKey | OVUAEAXLCSYUJY-UHFFFAOYSA-N |
| XLogP | 5.30 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.44 |
| LogP ≤ 5 | 5.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|