C23H21N9O12S5 — CID 135964689
5-[[4-[6-tert-butyl-7-[[3-(trioxidanylsulfanylsulfonyl)-1,2,4-thiadiazol-5-yl]diazenyl]-5H-pyrazolo[1,5-b][1,2,4]triazol-2-yl]phenyl]carbamoyl]benzene-1,3-disulfonic acid (PubChem CID 135964689) has the molecular formula C23H21N9O12S5 and a molecular weight of 775.81 g/mol. Its IUPAC name is 5-[[4-[6-tert-butyl-7-[[3-(trioxidanylsulfanylsulfonyl)-1,2,4-thiadiazol-5-yl]diazenyl]-5H-pyrazolo[1,5-b][1,2,4]triazol-2-yl]phenyl]carbamoyl]benzene-1,3-disulfonic acid.
| Compound Name | 5-[[4-[6-tert-butyl-7-[[3-(trioxidanylsulfanylsulfonyl)-1,2,4-thiadiazol-5-yl]diazenyl]-5H-pyrazolo[1,5-b][1,2,4]triazol-2-yl]phenyl]carbamoyl]benzene-1,3-disulfonic acid |
|---|---|
| PubChem CID | 135964689 |
| Molecular Formula | C23H21N9O12S5 |
| Molecular Weight | 775.81 g/mol |
| Exact Mass | 774.99 |
| IUPAC Name | 5-[[4-[6-tert-butyl-7-[[3-(trioxidanylsulfanylsulfonyl)-1,2,4-thiadiazol-5-yl]diazenyl]-5H-pyrazolo[1,5-b][1,2,4]triazol-2-yl]phenyl]carbamoyl]benzene-1,3-disulfonic acid |
| SMILES | CC(C)(C)c1[nH]n2nc(-c3ccc(NC(=O)c4cc(S(=O)(=O)O)cc(S(=O)(=O)O)c4)cc3)nc2c1/N=N/c1nc(S(=O)(=O)SOOO)ns1 |
| InChI | InChI=1S/C23H21N9O12S5/c1-23(2,3)17-16(27-28-21-26-22(31-45-21)49(41,42)46-44-43-34)19-25-18(30-32(19)29-17)11-4-6-13(7-5-11)24-20(33)12-8-14(47(35,36)37)10-15(9-12)48(38,39)40/h4-10,29,34H,1-3H3,(H,24,33)(H,35,36,37)(H,38,39,40)/b28-27+ |
| InChIKey | OFSBYEOENIGCKC-BYYHNAKLSA-N |
| XLogP | 3.79 |
| TPSA | 307.15 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 19 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 775.81 |
| LogP ≤ 5 | 3.79 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 19 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'disulphide', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|