C30H31ClIN11O — CID 136645820
1-[4-[6-tert-butyl-7-[(5-tert-butyl-4-cyano-1H-pyrazol-3-yl)diazenyl]-5H-pyrazolo[1,5-b][1,2,4]triazol-2-yl]phenyl]-3-[3-chloro-5-(iodomethyl)phenyl]urea (PubChem CID 136645820) has the molecular formula C30H31ClIN11O and a molecular weight of 724.01 g/mol. Its IUPAC name is 1-[4-[6-tert-butyl-7-[(5-tert-butyl-4-cyano-1H-pyrazol-3-yl)diazenyl]-5H-pyrazolo[1,5-b][1,2,4]triazol-2-yl]phenyl]-3-[3-chloro-5-(iodomethyl)phenyl]urea.
| Compound Name | 1-[4-[6-tert-butyl-7-[(5-tert-butyl-4-cyano-1H-pyrazol-3-yl)diazenyl]-5H-pyrazolo[1,5-b][1,2,4]triazol-2-yl]phenyl]-3-[3-chloro-5-(iodomethyl)phenyl]urea |
|---|---|
| PubChem CID | 136645820 |
| Molecular Formula | C30H31ClIN11O |
| Molecular Weight | 724.01 g/mol |
| Exact Mass | 723.14 |
| IUPAC Name | 1-[4-[6-tert-butyl-7-[(5-tert-butyl-4-cyano-1H-pyrazol-3-yl)diazenyl]-5H-pyrazolo[1,5-b][1,2,4]triazol-2-yl]phenyl]-3-[3-chloro-5-(iodomethyl)phenyl]urea |
| SMILES | CC(C)(C)c1[nH]nc(/N=N/c2c(C(C)(C)C)[nH]n3nc(-c4ccc(NC(=O)Nc5cc(Cl)cc(CI)c5)cc4)nc23)c1C#N |
| InChI | InChI=1S/C30H31ClIN11O/c1-29(2,3)23-21(15-33)26(40-38-23)39-37-22-24(30(4,5)6)41-43-27(22)36-25(42-43)17-7-9-19(10-8-17)34-28(44)35-20-12-16(14-32)11-18(31)13-20/h7-13,41H,14H2,1-6H3,(H,38,40)(H2,34,35,44)/b39-37+ |
| InChIKey | SYQIMNLTNVWJPF-NHFVQZBWSA-N |
| XLogP | 8.56 |
| TPSA | 164.30 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 724.01 |
| LogP ≤ 5 | 8.56 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|