C18H13N6O4S2- — CID 135965513
4-(2-acetamido-4-methyl-1,3-thiazol-5-yl)-N-[3-(2-oxo-3H-1,3,4-oxadiazol-5-yl)phenyl]-1,3-thiazole-2-carboximidate (PubChem CID 135965513) has the molecular formula C18H13N6O4S2- and a molecular weight of 441.47 g/mol. Its IUPAC name is 4-(2-acetamido-4-methyl-1,3-thiazol-5-yl)-N-[3-(2-oxo-3H-1,3,4-oxadiazol-5-yl)phenyl]-1,3-thiazole-2-carboximidate.
| Compound Name | 4-(2-acetamido-4-methyl-1,3-thiazol-5-yl)-N-[3-(2-oxo-3H-1,3,4-oxadiazol-5-yl)phenyl]-1,3-thiazole-2-carboximidate |
|---|---|
| PubChem CID | 135965513 |
| Molecular Formula | C18H13N6O4S2- |
| Molecular Weight | 441.47 g/mol |
| Exact Mass | 441.04 |
| IUPAC Name | 4-(2-acetamido-4-methyl-1,3-thiazol-5-yl)-N-[3-(2-oxo-3H-1,3,4-oxadiazol-5-yl)phenyl]-1,3-thiazole-2-carboximidate |
| SMILES | CC(=O)Nc1nc(C)c(-c2csc(/C([O-])=N/c3cccc(-c4n[nH]c(=O)o4)c3)n2)s1 |
| InChI | InChI=1S/C18H14N6O4S2/c1-8-13(30-17(19-8)20-9(2)25)12-7-29-16(22-12)14(26)21-11-5-3-4-10(6-11)15-23-24-18(27)28-15/h3-7H,1-2H3,(H,21,26)(H,24,27)(H,19,20,25)/p-1 |
| InChIKey | RCXWQPZIKRYCPX-UHFFFAOYSA-M |
| XLogP | 2.32 |
| TPSA | 149.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.47 |
| LogP ≤ 5 | 2.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|