C17H13N8O2S2- — CID 59465543
4-(2-acetamido-4-methyl-1,3-thiazol-5-yl)-N-[4-(2H-tetrazol-5-yl)phenyl]-1,3-thiazole-2-carboximidate (PubChem CID 59465543) has the molecular formula C17H13N8O2S2- and a molecular weight of 425.48 g/mol. Its IUPAC name is 4-(2-acetamido-4-methyl-1,3-thiazol-5-yl)-N-[4-(2H-tetrazol-5-yl)phenyl]-1,3-thiazole-2-carboximidate.
| Compound Name | 4-(2-acetamido-4-methyl-1,3-thiazol-5-yl)-N-[4-(2H-tetrazol-5-yl)phenyl]-1,3-thiazole-2-carboximidate |
|---|---|
| PubChem CID | 59465543 |
| Molecular Formula | C17H13N8O2S2- |
| Molecular Weight | 425.48 g/mol |
| Exact Mass | 425.06 |
| IUPAC Name | 4-(2-acetamido-4-methyl-1,3-thiazol-5-yl)-N-[4-(2H-tetrazol-5-yl)phenyl]-1,3-thiazole-2-carboximidate |
| SMILES | CC(=O)Nc1nc(C)c(-c2csc(/C([O-])=N/c3ccc(-c4nn[nH]n4)cc3)n2)s1 |
| InChI | InChI=1S/C17H14N8O2S2/c1-8-13(29-17(18-8)19-9(2)26)12-7-28-16(21-12)15(27)20-11-5-3-10(4-6-11)14-22-24-25-23-14/h3-7H,1-2H3,(H,20,27)(H,18,19,26)(H,22,23,24,25)/p-1 |
| InChIKey | DAAOMBSKPSGXTG-UHFFFAOYSA-M |
| XLogP | 2.15 |
| TPSA | 144.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.48 |
| LogP ≤ 5 | 2.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|