C16H17N4OS2+ — CID 3341375
[4-(2-acetamido-4-methyl-1,3-thiazol-5-yl)-1,3-thiazol-2-yl]-(4-methylphenyl)azanium (PubChem CID 3341375) has the molecular formula C16H17N4OS2+ and a molecular weight of 345.47 g/mol. Its IUPAC name is [4-(2-acetamido-4-methyl-1,3-thiazol-5-yl)-1,3-thiazol-2-yl]-(4-methylphenyl)azanium.
| Compound Name | [4-(2-acetamido-4-methyl-1,3-thiazol-5-yl)-1,3-thiazol-2-yl]-(4-methylphenyl)azanium |
|---|---|
| PubChem CID | 3341375 |
| Molecular Formula | C16H17N4OS2+ |
| Molecular Weight | 345.47 g/mol |
| Exact Mass | 345.08 |
| IUPAC Name | [4-(2-acetamido-4-methyl-1,3-thiazol-5-yl)-1,3-thiazol-2-yl]-(4-methylphenyl)azanium |
| SMILES | CC(=O)Nc1nc(C)c(-c2csc([NH2+]c3ccc(C)cc3)n2)s1 |
| InChI | InChI=1S/C16H16N4OS2/c1-9-4-6-12(7-5-9)19-15-20-13(8-22-15)14-10(2)17-16(23-14)18-11(3)21/h4-8H,1-3H3,(H,19,20)(H,17,18,21)/p+1 |
| InChIKey | FLVVAYJIHWYZCI-UHFFFAOYSA-O |
| XLogP | 3.37 |
| TPSA | 71.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.47 |
| LogP ≤ 5 | 3.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_no_alk(40)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|