C15H16N5O3S3+ — CID 3313510
[4-(2-acetamido-4-methyl-1,3-thiazol-5-yl)-1,3-thiazol-2-yl]-(4-sulfamoylphenyl)azanium (PubChem CID 3313510) has the molecular formula C15H16N5O3S3+ and a molecular weight of 410.53 g/mol. Its IUPAC name is [4-(2-acetamido-4-methyl-1,3-thiazol-5-yl)-1,3-thiazol-2-yl]-(4-sulfamoylphenyl)azanium.
| Compound Name | [4-(2-acetamido-4-methyl-1,3-thiazol-5-yl)-1,3-thiazol-2-yl]-(4-sulfamoylphenyl)azanium |
|---|---|
| PubChem CID | 3313510 |
| Molecular Formula | C15H16N5O3S3+ |
| Molecular Weight | 410.53 g/mol |
| Exact Mass | 410.04 |
| IUPAC Name | [4-(2-acetamido-4-methyl-1,3-thiazol-5-yl)-1,3-thiazol-2-yl]-(4-sulfamoylphenyl)azanium |
| SMILES | CC(=O)Nc1nc(C)c(-c2csc([NH2+]c3ccc(S(N)(=O)=O)cc3)n2)s1 |
| InChI | InChI=1S/C15H15N5O3S3/c1-8-13(25-15(17-8)18-9(2)21)12-7-24-14(20-12)19-10-3-5-11(6-4-10)26(16,22)23/h3-7H,1-2H3,(H,19,20)(H2,16,22,23)(H,17,18,21)/p+1 |
| InChIKey | VCGKDKBCSLTWKS-UHFFFAOYSA-O |
| XLogP | 1.71 |
| TPSA | 131.65 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.53 |
| LogP ≤ 5 | 1.71 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|