C16H14N4O3S2 — CID 159448235
N-[4-methyl-5-[2-[(4-nitrophenyl)methyl]-1,3-thiazol-4-yl]-1,3-thiazol-2-yl]acetamide (PubChem CID 159448235) has the molecular formula C16H14N4O3S2 and a molecular weight of 374.45 g/mol. Its IUPAC name is N-[4-methyl-5-[2-[(4-nitrophenyl)methyl]-1,3-thiazol-4-yl]-1,3-thiazol-2-yl]acetamide.
| Compound Name | N-[4-methyl-5-[2-[(4-nitrophenyl)methyl]-1,3-thiazol-4-yl]-1,3-thiazol-2-yl]acetamide |
|---|---|
| PubChem CID | 159448235 |
| Molecular Formula | C16H14N4O3S2 |
| Molecular Weight | 374.45 g/mol |
| Exact Mass | 374.05 |
| IUPAC Name | N-[4-methyl-5-[2-[(4-nitrophenyl)methyl]-1,3-thiazol-4-yl]-1,3-thiazol-2-yl]acetamide |
| SMILES | CC(=O)Nc1nc(C)c(-c2csc(Cc3ccc([N+](=O)[O-])cc3)n2)s1 |
| InChI | InChI=1S/C16H14N4O3S2/c1-9-15(25-16(17-9)18-10(2)21)13-8-24-14(19-13)7-11-3-5-12(6-4-11)20(22)23/h3-6,8H,7H2,1-2H3,(H,17,18,21) |
| InChIKey | LTAOEIFYERARGE-UHFFFAOYSA-N |
| XLogP | 4.03 |
| TPSA | 98.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.45 |
| LogP ≤ 5 | 4.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|