C24H24FN3 — CID 135966074
(4S,5R)-N-[(3-fluorophenyl)methyl]-4,5-bis(3-methylphenyl)imidazolidin-2-imine (PubChem CID 135966074) has the molecular formula C24H24FN3 and a molecular weight of 373.48 g/mol. Its IUPAC name is (4S,5R)-N-[(3-fluorophenyl)methyl]-4,5-bis(3-methylphenyl)imidazolidin-2-imine.
| Compound Name | (4S,5R)-N-[(3-fluorophenyl)methyl]-4,5-bis(3-methylphenyl)imidazolidin-2-imine |
|---|---|
| PubChem CID | 135966074 |
| Molecular Formula | C24H24FN3 |
| Molecular Weight | 373.48 g/mol |
| Exact Mass | 373.20 |
| IUPAC Name | (4S,5R)-N-[(3-fluorophenyl)methyl]-4,5-bis(3-methylphenyl)imidazolidin-2-imine |
| SMILES | Cc1cccc([C@H]2N/C(=N\Cc3cccc(F)c3)N[C@H]2c2cccc(C)c2)c1 |
| InChI | InChI=1S/C24H24FN3/c1-16-6-3-9-19(12-16)22-23(20-10-4-7-17(2)13-20)28-24(27-22)26-15-18-8-5-11-21(25)14-18/h3-14,22-23H,15H2,1-2H3,(H2,26,27,28)/t22-,23+ |
| InChIKey | ILWIFXREUGXHMS-ZRZAMGCNSA-N |
| XLogP | 4.97 |
| TPSA | 36.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.48 |
| LogP ≤ 5 | 4.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|