C19H24N4O3 — CID 135966419
N-[(2-tert-butyl-6-oxo-1H-pyrimidin-4-yl)methyl]-N'-(2,5-dimethylphenyl)oxamide (PubChem CID 135966419) has the molecular formula C19H24N4O3 and a molecular weight of 356.43 g/mol. Its IUPAC name is N-[(2-tert-butyl-6-oxo-1H-pyrimidin-4-yl)methyl]-N'-(2,5-dimethylphenyl)oxamide.
| Compound Name | N-[(2-tert-butyl-6-oxo-1H-pyrimidin-4-yl)methyl]-N'-(2,5-dimethylphenyl)oxamide |
|---|---|
| PubChem CID | 135966419 |
| Molecular Formula | C19H24N4O3 |
| Molecular Weight | 356.43 g/mol |
| Exact Mass | 356.18 |
| IUPAC Name | N-[(2-tert-butyl-6-oxo-1H-pyrimidin-4-yl)methyl]-N'-(2,5-dimethylphenyl)oxamide |
| SMILES | Cc1ccc(C)c(NC(=O)C(=O)NCc2cc(=O)[nH]c(C(C)(C)C)n2)c1 |
| InChI | InChI=1S/C19H24N4O3/c1-11-6-7-12(2)14(8-11)22-17(26)16(25)20-10-13-9-15(24)23-18(21-13)19(3,4)5/h6-9H,10H2,1-5H3,(H,20,25)(H,22,26)(H,21,23,24) |
| InChIKey | LYUIAXSXCPICLL-UHFFFAOYSA-N |
| XLogP | 1.94 |
| TPSA | 103.95 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.43 |
| LogP ≤ 5 | 1.94 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|