C10H22N8O4-2 — CID 135967006
(Z)-oxido-oxidoimino-[11-[(Z)-oxido(oxidoimino)azaniumyl]-1,4,8,11-tetrazacyclotetradec-1-yl]azanium (PubChem CID 135967006) has the molecular formula C10H22N8O4-2 and a molecular weight of 318.34 g/mol. Its IUPAC name is (Z)-oxido-oxidoimino-[11-[(Z)-oxido(oxidoimino)azaniumyl]-1,4,8,11-tetrazacyclotetradec-1-yl]azanium.
| Compound Name | (Z)-oxido-oxidoimino-[11-[(Z)-oxido(oxidoimino)azaniumyl]-1,4,8,11-tetrazacyclotetradec-1-yl]azanium |
|---|---|
| PubChem CID | 135967006 |
| Molecular Formula | C10H22N8O4-2 |
| Molecular Weight | 318.34 g/mol |
| Exact Mass | 318.18 |
| IUPAC Name | (Z)-oxido-oxidoimino-[11-[(Z)-oxido(oxidoimino)azaniumyl]-1,4,8,11-tetrazacyclotetradec-1-yl]azanium |
| SMILES | [O-]/N=[N+](\[O-])N1CCCN(/[N+]([O-])=N/[O-])CCNCCCNCC1 |
| InChI | InChI=1S/C10H24N8O4/c19-13-17(21)15-7-2-8-16(18(22)14-20)10-6-12-4-1-3-11-5-9-15/h11-12,19-20H,1-10H2/p-2/b17-13-,18-14- |
| InChIKey | ORQPKOVMFKJKJE-JTFWXBGUSA-L |
| XLogP | -0.69 |
| TPSA | 153.52 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.34 |
| LogP ≤ 5 | -0.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'N_oxide', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|