C28H31IrN2OS- — CID 135967412
2-(3H-1-benzothiophen-3-id-2-yl)pyridine;2-(hexyliminomethyl)-4,6-dimethylphenol;iridium (PubChem CID 135967412) has the molecular formula C28H31IrN2OS- and a molecular weight of 635.85 g/mol. Its IUPAC name is 2-(3H-1-benzothiophen-3-id-2-yl)pyridine;2-(hexyliminomethyl)-4,6-dimethylphenol;iridium.
| Compound Name | 2-(3H-1-benzothiophen-3-id-2-yl)pyridine;2-(hexyliminomethyl)-4,6-dimethylphenol;iridium |
|---|---|
| PubChem CID | 135967412 |
| Molecular Formula | C28H31IrN2OS- |
| Molecular Weight | 635.85 g/mol |
| Exact Mass | 636.18 |
| IUPAC Name | 2-(3H-1-benzothiophen-3-id-2-yl)pyridine;2-(hexyliminomethyl)-4,6-dimethylphenol;iridium |
| SMILES | CCCCCC/N=C/c1cc(C)cc(C)c1O.[Ir].[c-]1c(-c2ccccn2)sc2ccccc12 |
| InChI | InChI=1S/C15H23NO.C13H8NS.Ir/c1-4-5-6-7-8-16-11-14-10-12(2)9-13(3)15(14)17;1-2-7-12-10(5-1)9-13(15-12)11-6-3-4-8-14-11;/h9-11,17H,4-8H2,1-3H3;1-8H;/q;-1;/b16-11+;; |
| InChIKey | IRNZTHIKGFEBDU-RPVSWQTKSA-N |
| XLogP | 7.77 |
| TPSA | 45.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 635.85 |
| LogP ≤ 5 | 7.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|