C23H19NO4S — CID 135968452
4-hydroxy-3-[2-(4-methylphenoxy)ethyl]-5-[(Z)-(2-oxonaphthalen-1-ylidene)methyl]-1,3-thiazol-2-one (PubChem CID 135968452) has the molecular formula C23H19NO4S and a molecular weight of 405.48 g/mol. Its IUPAC name is 4-hydroxy-3-[2-(4-methylphenoxy)ethyl]-5-[(Z)-(2-oxonaphthalen-1-ylidene)methyl]-1,3-thiazol-2-one.
| Compound Name | 4-hydroxy-3-[2-(4-methylphenoxy)ethyl]-5-[(Z)-(2-oxonaphthalen-1-ylidene)methyl]-1,3-thiazol-2-one |
|---|---|
| PubChem CID | 135968452 |
| Molecular Formula | C23H19NO4S |
| Molecular Weight | 405.48 g/mol |
| Exact Mass | 405.10 |
| IUPAC Name | 4-hydroxy-3-[2-(4-methylphenoxy)ethyl]-5-[(Z)-(2-oxonaphthalen-1-ylidene)methyl]-1,3-thiazol-2-one |
| SMILES | Cc1ccc(OCCn2c(O)c(/C=C3\C(=O)C=Cc4ccccc43)sc2=O)cc1 |
| InChI | InChI=1S/C23H19NO4S/c1-15-6-9-17(10-7-15)28-13-12-24-22(26)21(29-23(24)27)14-19-18-5-3-2-4-16(18)8-11-20(19)25/h2-11,14,26H,12-13H2,1H3/b19-14- |
| InChIKey | BYZPJXQRRXUJOL-RGEXLXHISA-N |
| XLogP | 4.14 |
| TPSA | 68.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.48 |
| LogP ≤ 5 | 4.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|