C21H16N2O2S — CID 1251052
1-[[4-hydroxy-2-(3-methylanilino)-1,3-thiazol-5-yl]methylidene]naphthalen-2-one (PubChem CID 1251052) has the molecular formula C21H16N2O2S and a molecular weight of 360.44 g/mol. Its IUPAC name is 1-[[4-hydroxy-2-(3-methylanilino)-1,3-thiazol-5-yl]methylidene]naphthalen-2-one.
| Compound Name | 1-[[4-hydroxy-2-(3-methylanilino)-1,3-thiazol-5-yl]methylidene]naphthalen-2-one |
|---|---|
| PubChem CID | 1251052 |
| Molecular Formula | C21H16N2O2S |
| Molecular Weight | 360.44 g/mol |
| Exact Mass | 360.09 |
| IUPAC Name | 1-[[4-hydroxy-2-(3-methylanilino)-1,3-thiazol-5-yl]methylidene]naphthalen-2-one |
| SMILES | Cc1cccc(Nc2nc(O)c(C=C3C(=O)C=Cc4ccccc43)s2)c1 |
| InChI | InChI=1S/C21H16N2O2S/c1-13-5-4-7-15(11-13)22-21-23-20(25)19(26-21)12-17-16-8-3-2-6-14(16)9-10-18(17)24/h2-12,25H,1H3,(H,22,23) |
| InChIKey | JCONNAFGBYWDEE-UHFFFAOYSA-N |
| XLogP | 5.04 |
| TPSA | 62.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.44 |
| LogP ≤ 5 | 5.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|