About 2-(4-methoxyanilino)-5-[(5-methoxy-2-phenylindol-3-ylidene)methyl]-1,3-thiazol-4-ol
2-(4-methoxyanilino)-5-[(5-methoxy-2-phenylindol-3-ylidene)methyl]-1,3-thiazol-4-ol (PubChem CID 137107291) has the molecular formula C26H21N3O3S
and a molecular weight of 455.54 g/mol. Its IUPAC name is 2-(4-methoxyanilino)-5-[(5-methoxy-2-phenylindol-3-ylidene)methyl]-1,3-thiazol-4-ol.
Molecular Properties
| Compound Name | 2-(4-methoxyanilino)-5-[(5-methoxy-2-phenylindol-3-ylidene)methyl]-1,3-thiazol-4-ol |
| PubChem CID | 137107291 |
| Molecular Formula | C26H21N3O3S |
| Molecular Weight | 455.54 g/mol |
| Exact Mass | 455.13 |
| IUPAC Name | 2-(4-methoxyanilino)-5-[(5-methoxy-2-phenylindol-3-ylidene)methyl]-1,3-thiazol-4-ol |
| SMILES | COc1ccc(Nc2nc(O)c(C=C3C(c4ccccc4)=Nc4ccc(OC)cc43)s2)cc1 |
| InChI | InChI=1S/C26H21N3O3S/c1-31-18-10-8-17(9-11-18)27-26-29-25(30)23(33-26)15-21-20-14-19(32-2)12-13-22(20)28-24(21)16-6-4-3-5-7-16/h3-15,30H,1-2H3,(H,27,29) |
| InChIKey | DVBLVHWROFCNSI-UHFFFAOYSA-N |
| XLogP | 6.28 |
| TPSA | 75.97 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 455.54 |
| LogP ≤ 5 | 6.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
Analyze 2-(4-methoxyanilino)-5-[(5-methoxy-2-phenylindol-3-ylidene)methyl]-1,3-thiazol-4-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(4-methoxyanilino)-5-[(5-methoxy-2-phenylindol-3-ylidene)methyl]-1,3-thiazol-4-ol?
The IUPAC name of 2-(4-methoxyanilino)-5-[(5-methoxy-2-phenylindol-3-ylidene)methyl]-1,3-thiazol-4-ol (CID 137107291) is 2-(4-methoxyanilino)-5-[(5-methoxy-2-phenylindol-3-ylidene)methyl]-1,3-thiazol-4-ol.
What is the SMILES notation for 2-(4-methoxyanilino)-5-[(5-methoxy-2-phenylindol-3-ylidene)methyl]-1,3-thiazol-4-ol?
The canonical SMILES for 2-(4-methoxyanilino)-5-[(5-methoxy-2-phenylindol-3-ylidene)methyl]-1,3-thiazol-4-ol is COc1ccc(Nc2nc(O)c(C=C3C(c4ccccc4)=Nc4ccc(OC)cc43)s2)cc1.
What is the InChIKey of 2-(4-methoxyanilino)-5-[(5-methoxy-2-phenylindol-3-ylidene)methyl]-1,3-thiazol-4-ol?
The InChIKey is DVBLVHWROFCNSI-UHFFFAOYSA-N. The full InChI is InChI=1S/C26H21N3O3S/c1-31-18-10-8-17(9-11-18)27-26-29-25(30)23(33-26)15-21-20-14-19(32-2)12-13-22(20)28-24(21)16-6-4-3-5-7-16/h3-15,30H,1-2H3,(H,27,29).
What are the key properties of 2-(4-methoxyanilino)-5-[(5-methoxy-2-phenylindol-3-ylidene)methyl]-1,3-thiazol-4-ol?
2-(4-methoxyanilino)-5-[(5-methoxy-2-phenylindol-3-ylidene)methyl]-1,3-thiazol-4-ol has a molecular weight of 455.54 g/mol, XLogP of 6.28, 6 rotatable bonds, 2 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(4-methoxyanilino)-5-[(5-methoxy-2-phenylindol-3-ylidene)methyl]-1,3-thiazol-4-ol is sourced from PubChem (CID 137107291), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).