C26H23NO4 — CID 137021959
methyl 1-(4-ethylphenyl)-5-hydroxy-2-methyl-4-[(2-oxonaphthalen-1-ylidene)methyl]pyrrole-3-carboxylate (PubChem CID 137021959) has the molecular formula C26H23NO4 and a molecular weight of 413.47 g/mol. Its IUPAC name is methyl 1-(4-ethylphenyl)-5-hydroxy-2-methyl-4-[(2-oxonaphthalen-1-ylidene)methyl]pyrrole-3-carboxylate.
| Compound Name | methyl 1-(4-ethylphenyl)-5-hydroxy-2-methyl-4-[(2-oxonaphthalen-1-ylidene)methyl]pyrrole-3-carboxylate |
|---|---|
| PubChem CID | 137021959 |
| Molecular Formula | C26H23NO4 |
| Molecular Weight | 413.47 g/mol |
| Exact Mass | 413.16 |
| IUPAC Name | methyl 1-(4-ethylphenyl)-5-hydroxy-2-methyl-4-[(2-oxonaphthalen-1-ylidene)methyl]pyrrole-3-carboxylate |
| SMILES | CCc1ccc(-n2c(C)c(C(=O)OC)c(C=C3C(=O)C=Cc4ccccc43)c2O)cc1 |
| InChI | InChI=1S/C26H23NO4/c1-4-17-9-12-19(13-10-17)27-16(2)24(26(30)31-3)22(25(27)29)15-21-20-8-6-5-7-18(20)11-14-23(21)28/h5-15,29H,4H2,1-3H3 |
| InChIKey | IWLDBSTYDJZYGZ-UHFFFAOYSA-N |
| XLogP | 4.98 |
| TPSA | 68.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.47 |
| LogP ≤ 5 | 4.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|