C40H34N2O11V2 — CID 11320363
bis((2S)-3-(4-hydroxyphenyl)-2-[[(Z)-(2-oxonaphthalen-1-ylidene)methyl]amino]propanoic acid);oxo(oxovanadiooxy)vanadium (PubChem CID 11320363) has the molecular formula C40H34N2O11V2 and a molecular weight of 820.60 g/mol. Its IUPAC name is bis((2S)-3-(4-hydroxyphenyl)-2-[[(Z)-(2-oxonaphthalen-1-ylidene)methyl]amino]propanoic acid);oxo(oxovanadiooxy)vanadium.
| Compound Name | bis((2S)-3-(4-hydroxyphenyl)-2-[[(Z)-(2-oxonaphthalen-1-ylidene)methyl]amino]propanoic acid);oxo(oxovanadiooxy)vanadium |
|---|---|
| PubChem CID | 11320363 |
| Molecular Formula | C40H34N2O11V2 |
| Molecular Weight | 820.60 g/mol |
| Exact Mass | 820.10 |
| IUPAC Name | bis((2S)-3-(4-hydroxyphenyl)-2-[[(Z)-(2-oxonaphthalen-1-ylidene)methyl]amino]propanoic acid);oxo(oxovanadiooxy)vanadium |
| SMILES | O=C1C=Cc2ccccc2/C1=C/N[C@@H](Cc1ccc(O)cc1)C(=O)O.O=C1C=Cc2ccccc2/C1=C/N[C@@H](Cc1ccc(O)cc1)C(=O)O.O=[V]O[V]=O |
| InChI | InChI=1S/2C20H17NO4.3O.2V/c2*22-15-8-5-13(6-9-15)11-18(20(24)25)21-12-17-16-4-2-1-3-14(16)7-10-19(17)23;;;;;/h2*1-10,12,18,21-22H,11H2,(H,24,25);;;;;/b2*17-12-;;;;;/t2*18-;;;;;/m00...../s1 |
| InChIKey | CORQONBMDMJELM-BDFCAEKMSA-N |
| XLogP | 4.92 |
| TPSA | 216.63 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 55 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 820.60 |
| LogP ≤ 5 | 4.92 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|