C17H17NO6 — CID 88708876
2-[[[(1S)-1-carboxy-2-(4-hydroxyphenyl)ethyl]amino]oxymethyl]benzoic acid (PubChem CID 88708876) has the molecular formula C17H17NO6 and a molecular weight of 331.32 g/mol. Its IUPAC name is 2-[[[(1S)-1-carboxy-2-(4-hydroxyphenyl)ethyl]amino]oxymethyl]benzoic acid.
| Compound Name | 2-[[[(1S)-1-carboxy-2-(4-hydroxyphenyl)ethyl]amino]oxymethyl]benzoic acid |
|---|---|
| PubChem CID | 88708876 |
| Molecular Formula | C17H17NO6 |
| Molecular Weight | 331.32 g/mol |
| Exact Mass | 331.11 |
| IUPAC Name | 2-[[[(1S)-1-carboxy-2-(4-hydroxyphenyl)ethyl]amino]oxymethyl]benzoic acid |
| SMILES | O=C(O)c1ccccc1CON[C@@H](Cc1ccc(O)cc1)C(=O)O |
| InChI | InChI=1S/C17H17NO6/c19-13-7-5-11(6-8-13)9-15(17(22)23)18-24-10-12-3-1-2-4-14(12)16(20)21/h1-8,15,18-19H,9-10H2,(H,20,21)(H,22,23)/t15-/m0/s1 |
| InChIKey | UUTGUOVBNIXTKW-HNNXBMFYSA-N |
| XLogP | 1.81 |
| TPSA | 116.09 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.32 |
| LogP ≤ 5 | 1.81 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|