C12H13N3O4V — CID 6850302
1-[[2-[amino(hydroxy)methyl]hydrazinyl]methylidene]naphthalen-2-one;dioxovanadium (PubChem CID 6850302) has the molecular formula C12H13N3O4V and a molecular weight of 314.20 g/mol. Its IUPAC name is 1-[[2-[amino(hydroxy)methyl]hydrazinyl]methylidene]naphthalen-2-one;dioxovanadium.
| Compound Name | 1-[[2-[amino(hydroxy)methyl]hydrazinyl]methylidene]naphthalen-2-one;dioxovanadium |
|---|---|
| PubChem CID | 6850302 |
| Molecular Formula | C12H13N3O4V |
| Molecular Weight | 314.20 g/mol |
| Exact Mass | 314.03 |
| IUPAC Name | 1-[[2-[amino(hydroxy)methyl]hydrazinyl]methylidene]naphthalen-2-one;dioxovanadium |
| SMILES | NC(O)NNC=C1C(=O)C=Cc2ccccc21.O=[V]=O |
| InChI | InChI=1S/C12H13N3O2.2O.V/c13-12(17)15-14-7-10-9-4-2-1-3-8(9)5-6-11(10)16;;;/h1-7,12,14-15,17H,13H2;;; |
| InChIKey | BJCSQOWOIOHKJR-UHFFFAOYSA-N |
| XLogP | -0.29 |
| TPSA | 121.52 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.20 |
| LogP ≤ 5 | -0.29 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|