C15H17NO2 — CID 173281078
1-[[tert-butyl(hydroxy)amino]methylidene]naphthalen-2-one (PubChem CID 173281078) has the molecular formula C15H17NO2 and a molecular weight of 243.31 g/mol. Its IUPAC name is 1-[[tert-butyl(hydroxy)amino]methylidene]naphthalen-2-one.
| Compound Name | 1-[[tert-butyl(hydroxy)amino]methylidene]naphthalen-2-one |
|---|---|
| PubChem CID | 173281078 |
| Molecular Formula | C15H17NO2 |
| Molecular Weight | 243.31 g/mol |
| Exact Mass | 243.13 |
| IUPAC Name | 1-[[tert-butyl(hydroxy)amino]methylidene]naphthalen-2-one |
| SMILES | CC(C)(C)N(O)C=C1C(=O)C=Cc2ccccc21 |
| InChI | InChI=1S/C15H17NO2/c1-15(2,3)16(18)10-13-12-7-5-4-6-11(12)8-9-14(13)17/h4-10,18H,1-3H3 |
| InChIKey | KHZHWEIMCCVDFA-UHFFFAOYSA-N |
| XLogP | 3.11 |
| TPSA | 40.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 243.31 |
| LogP ≤ 5 | 3.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|