C21H15NO3 — CID 135481408
(1Z)-1-[[5-hydroxy-2-(2-methylphenyl)-1,3-oxazol-4-yl]methylidene]naphthalen-2-one (PubChem CID 135481408) has the molecular formula C21H15NO3 and a molecular weight of 329.36 g/mol. Its IUPAC name is (1Z)-1-[[5-hydroxy-2-(2-methylphenyl)-1,3-oxazol-4-yl]methylidene]naphthalen-2-one.
| Compound Name | (1Z)-1-[[5-hydroxy-2-(2-methylphenyl)-1,3-oxazol-4-yl]methylidene]naphthalen-2-one |
|---|---|
| PubChem CID | 135481408 |
| Molecular Formula | C21H15NO3 |
| Molecular Weight | 329.36 g/mol |
| Exact Mass | 329.11 |
| IUPAC Name | (1Z)-1-[[5-hydroxy-2-(2-methylphenyl)-1,3-oxazol-4-yl]methylidene]naphthalen-2-one |
| SMILES | Cc1ccccc1-c1nc(/C=C2\C(=O)C=Cc3ccccc32)c(O)o1 |
| InChI | InChI=1S/C21H15NO3/c1-13-6-2-4-8-15(13)20-22-18(21(24)25-20)12-17-16-9-5-3-7-14(16)10-11-19(17)23/h2-12,24H,1H3/b17-12- |
| InChIKey | YNCPROAUJHEQIY-ATVHPVEESA-N |
| XLogP | 4.49 |
| TPSA | 63.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.36 |
| LogP ≤ 5 | 4.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|