C15H11NO2S2 — CID 135962756
(1Z)-1-[(4-hydroxy-3-methyl-2-sulfanylidene-1,3-thiazol-5-yl)methylidene]naphthalen-2-one (PubChem CID 135962756) has the molecular formula C15H11NO2S2 and a molecular weight of 301.39 g/mol. Its IUPAC name is (1Z)-1-[(4-hydroxy-3-methyl-2-sulfanylidene-1,3-thiazol-5-yl)methylidene]naphthalen-2-one.
| Compound Name | (1Z)-1-[(4-hydroxy-3-methyl-2-sulfanylidene-1,3-thiazol-5-yl)methylidene]naphthalen-2-one |
|---|---|
| PubChem CID | 135962756 |
| Molecular Formula | C15H11NO2S2 |
| Molecular Weight | 301.39 g/mol |
| Exact Mass | 301.02 |
| IUPAC Name | (1Z)-1-[(4-hydroxy-3-methyl-2-sulfanylidene-1,3-thiazol-5-yl)methylidene]naphthalen-2-one |
| SMILES | Cn1c(O)c(/C=C2\C(=O)C=Cc3ccccc32)sc1=S |
| InChI | InChI=1S/C15H11NO2S2/c1-16-14(18)13(20-15(16)19)8-11-10-5-3-2-4-9(10)6-7-12(11)17/h2-8,18H,1H3/b11-8- |
| InChIKey | FBCRTMVYZGQCJG-FLIBITNWSA-N |
| XLogP | 3.66 |
| TPSA | 42.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.39 |
| LogP ≤ 5 | 3.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|