C25H21NO3Sn — CID 10791509
diphenyltin;2-[[(Z)-(2-oxonaphthalen-1-ylidene)methyl]amino]acetic acid (PubChem CID 10791509) has the molecular formula C25H21NO3Sn and a molecular weight of 502.16 g/mol. Its IUPAC name is diphenyltin;2-[[(Z)-(2-oxonaphthalen-1-ylidene)methyl]amino]acetic acid.
| Compound Name | diphenyltin;2-[[(Z)-(2-oxonaphthalen-1-ylidene)methyl]amino]acetic acid |
|---|---|
| PubChem CID | 10791509 |
| Molecular Formula | C25H21NO3Sn |
| Molecular Weight | 502.16 g/mol |
| Exact Mass | 503.05 |
| IUPAC Name | diphenyltin;2-[[(Z)-(2-oxonaphthalen-1-ylidene)methyl]amino]acetic acid |
| SMILES | O=C(O)CN/C=C1\C(=O)C=Cc2ccccc21.c1ccc([Sn]c2ccccc2)cc1 |
| InChI | InChI=1S/C13H11NO3.2C6H5.Sn/c15-12-6-5-9-3-1-2-4-10(9)11(12)7-14-8-13(16)17;2*1-2-4-6-5-3-1;/h1-7,14H,8H2,(H,16,17);2*1-5H;/b11-7-;;; |
| InChIKey | SBELHEUHZURJIJ-DYCOYGMPSA-N |
| XLogP | 2.64 |
| TPSA | 66.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 502.16 |
| LogP ≤ 5 | 2.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|