C22H23NO2 — CID 67906959
2-amino-7-(2-tricyclo[9.4.0.03,8]pentadeca-1(15),3,5,7,9,11,13-heptaenylidene)heptanoic acid (PubChem CID 67906959) has the molecular formula C22H23NO2 and a molecular weight of 333.43 g/mol. Its IUPAC name is 2-amino-7-(2-tricyclo[9.4.0.03,8]pentadeca-1(15),3,5,7,9,11,13-heptaenylidene)heptanoic acid.
| Compound Name | 2-amino-7-(2-tricyclo[9.4.0.03,8]pentadeca-1(15),3,5,7,9,11,13-heptaenylidene)heptanoic acid |
|---|---|
| PubChem CID | 67906959 |
| Molecular Formula | C22H23NO2 |
| Molecular Weight | 333.43 g/mol |
| Exact Mass | 333.17 |
| IUPAC Name | 2-amino-7-(2-tricyclo[9.4.0.03,8]pentadeca-1(15),3,5,7,9,11,13-heptaenylidene)heptanoic acid |
| SMILES | NC(CCCCC=C1c2ccccc2C=Cc2ccccc21)C(=O)O |
| InChI | InChI=1S/C22H23NO2/c23-21(22(24)25)13-3-1-2-12-20-18-10-6-4-8-16(18)14-15-17-9-5-7-11-19(17)20/h4-12,14-15,21H,1-3,13,23H2,(H,24,25) |
| InChIKey | NVLPVZJHMFLLOD-UHFFFAOYSA-N |
| XLogP | 4.57 |
| TPSA | 63.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.43 |
| LogP ≤ 5 | 4.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|