C35H23N3O2 — CID 6121926
(1Z)-1-[[[6-[[(E)-(2-oxonaphthalen-1-ylidene)methyl]amino]acridin-3-yl]amino]methylidene]naphthalen-2-one (PubChem CID 6121926) has the molecular formula C35H23N3O2 and a molecular weight of 517.59 g/mol. Its IUPAC name is (1Z)-1-[[[6-[[(E)-(2-oxonaphthalen-1-ylidene)methyl]amino]acridin-3-yl]amino]methylidene]naphthalen-2-one.
| Compound Name | (1Z)-1-[[[6-[[(E)-(2-oxonaphthalen-1-ylidene)methyl]amino]acridin-3-yl]amino]methylidene]naphthalen-2-one |
|---|---|
| PubChem CID | 6121926 |
| Molecular Formula | C35H23N3O2 |
| Molecular Weight | 517.59 g/mol |
| Exact Mass | 517.18 |
| IUPAC Name | (1Z)-1-[[[6-[[(E)-(2-oxonaphthalen-1-ylidene)methyl]amino]acridin-3-yl]amino]methylidene]naphthalen-2-one |
| SMILES | O=C1C=Cc2ccccc2/C1=C/Nc1ccc2cc3ccc(N/C=C4/C(=O)C=Cc5ccccc54)cc3nc2c1 |
| InChI | InChI=1S/C35H23N3O2/c39-34-15-11-22-5-1-3-7-28(22)30(34)20-36-26-13-9-24-17-25-10-14-27(19-33(25)38-32(24)18-26)37-21-31-29-8-4-2-6-23(29)12-16-35(31)40/h1-21,36-37H/b30-20-,31-21+ |
| InChIKey | GWBIYXUSBPVIGP-IZDIRFCDSA-N |
| XLogP | 7.49 |
| TPSA | 71.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 517.59 |
| LogP ≤ 5 | 7.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|