C40H34N2O9V2 — CID 11251316
bis((2S)-2-[[(Z)-(2-oxonaphthalen-1-ylidene)methyl]amino]-3-phenylpropanoic acid);oxo(oxovanadiooxy)vanadium (PubChem CID 11251316) has the molecular formula C40H34N2O9V2 and a molecular weight of 788.61 g/mol. Its IUPAC name is bis((2S)-2-[[(Z)-(2-oxonaphthalen-1-ylidene)methyl]amino]-3-phenylpropanoic acid);oxo(oxovanadiooxy)vanadium.
| Compound Name | bis((2S)-2-[[(Z)-(2-oxonaphthalen-1-ylidene)methyl]amino]-3-phenylpropanoic acid);oxo(oxovanadiooxy)vanadium |
|---|---|
| PubChem CID | 11251316 |
| Molecular Formula | C40H34N2O9V2 |
| Molecular Weight | 788.61 g/mol |
| Exact Mass | 788.11 |
| IUPAC Name | bis((2S)-2-[[(Z)-(2-oxonaphthalen-1-ylidene)methyl]amino]-3-phenylpropanoic acid);oxo(oxovanadiooxy)vanadium |
| SMILES | O=C1C=Cc2ccccc2/C1=C/N[C@@H](Cc1ccccc1)C(=O)O.O=C1C=Cc2ccccc2/C1=C/N[C@@H](Cc1ccccc1)C(=O)O.O=[V]O[V]=O |
| InChI | InChI=1S/2C20H17NO3.3O.2V/c2*22-19-11-10-15-8-4-5-9-16(15)17(19)13-21-18(20(23)24)12-14-6-2-1-3-7-14;;;;;/h2*1-11,13,18,21H,12H2,(H,23,24);;;;;/b2*17-13-;;;;;/t2*18-;;;;;/m00...../s1 |
| InChIKey | GYYVKODTHVPJTK-ZECCTECESA-N |
| XLogP | 5.51 |
| TPSA | 176.17 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 53 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 788.61 |
| LogP ≤ 5 | 5.51 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|