C28H25NO7 — CID 23244264
dimethyl 2-[9-methoxycarbonyl-2-(4-methoxyphenyl)-3-methylazuleno[1,2-c]pyrrol-1-yl]but-2-enedioate (PubChem CID 23244264) has the molecular formula C28H25NO7 and a molecular weight of 487.51 g/mol. Its IUPAC name is dimethyl 2-[9-methoxycarbonyl-2-(4-methoxyphenyl)-3-methylazuleno[1,2-c]pyrrol-1-yl]but-2-enedioate.
| Compound Name | dimethyl 2-[9-methoxycarbonyl-2-(4-methoxyphenyl)-3-methylazuleno[1,2-c]pyrrol-1-yl]but-2-enedioate |
|---|---|
| PubChem CID | 23244264 |
| Molecular Formula | C28H25NO7 |
| Molecular Weight | 487.51 g/mol |
| Exact Mass | 487.16 |
| IUPAC Name | dimethyl 2-[9-methoxycarbonyl-2-(4-methoxyphenyl)-3-methylazuleno[1,2-c]pyrrol-1-yl]but-2-enedioate |
| SMILES | COC(=O)C=C(C(=O)OC)c1c2c(C(=O)OC)c3cccccc-3c2c(C)n1-c1ccc(OC)cc1 |
| InChI | InChI=1S/C28H25NO7/c1-16-23-19-9-7-6-8-10-20(19)24(28(32)36-5)25(23)26(21(27(31)35-4)15-22(30)34-3)29(16)17-11-13-18(33-2)14-12-17/h6-15H,1-5H3 |
| InChIKey | ZMPULCBYUDTUQS-UHFFFAOYSA-N |
| XLogP | 4.57 |
| TPSA | 93.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 487.51 |
| LogP ≤ 5 | 4.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|