C19H19N4O6+ — CID 10834664
dimethyl (Z)-2-(7-methoxycarbonyl-2-methyl-6-phenyl-3H-pyrrolo[2,1-e]tetrazol-2-ium-5-yl)but-2-enedioate (PubChem CID 10834664) has the molecular formula C19H19N4O6+ and a molecular weight of 399.38 g/mol. Its IUPAC name is dimethyl (Z)-2-(7-methoxycarbonyl-2-methyl-6-phenyl-3H-pyrrolo[2,1-e]tetrazol-2-ium-5-yl)but-2-enedioate.
| Compound Name | dimethyl (Z)-2-(7-methoxycarbonyl-2-methyl-6-phenyl-3H-pyrrolo[2,1-e]tetrazol-2-ium-5-yl)but-2-enedioate |
|---|---|
| PubChem CID | 10834664 |
| Molecular Formula | C19H19N4O6+ |
| Molecular Weight | 399.38 g/mol |
| Exact Mass | 399.13 |
| IUPAC Name | dimethyl (Z)-2-(7-methoxycarbonyl-2-methyl-6-phenyl-3H-pyrrolo[2,1-e]tetrazol-2-ium-5-yl)but-2-enedioate |
| SMILES | COC(=O)/C=C(\C(=O)OC)c1c(-c2ccccc2)c(C(=O)OC)c2n[n+](C)[nH]n12 |
| InChI | InChI=1S/C19H18N4O6/c1-22-20-17-15(19(26)29-4)14(11-8-6-5-7-9-11)16(23(17)21-22)12(18(25)28-3)10-13(24)27-2/h5-10H,1-4H3/p+1 |
| InChIKey | RYMSFLPAPLYGBX-UHFFFAOYSA-O |
| XLogP | 0.67 |
| TPSA | 115.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.38 |
| LogP ≤ 5 | 0.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|