C19H21NO5 — CID 54685005
methyl 1-[(E)-3-hydroxy-1-methoxy-1-oxobut-2-en-2-yl]-2,5-dimethyl-4-phenylpyrrole-3-carboxylate (PubChem CID 54685005) has the molecular formula C19H21NO5 and a molecular weight of 343.38 g/mol. Its IUPAC name is methyl 1-[(E)-3-hydroxy-1-methoxy-1-oxobut-2-en-2-yl]-2,5-dimethyl-4-phenylpyrrole-3-carboxylate.
| Compound Name | methyl 1-[(E)-3-hydroxy-1-methoxy-1-oxobut-2-en-2-yl]-2,5-dimethyl-4-phenylpyrrole-3-carboxylate |
|---|---|
| PubChem CID | 54685005 |
| Molecular Formula | C19H21NO5 |
| Molecular Weight | 343.38 g/mol |
| Exact Mass | 343.14 |
| IUPAC Name | methyl 1-[(E)-3-hydroxy-1-methoxy-1-oxobut-2-en-2-yl]-2,5-dimethyl-4-phenylpyrrole-3-carboxylate |
| SMILES | COC(=O)/C(=C(/C)O)n1c(C)c(C(=O)OC)c(-c2ccccc2)c1C |
| InChI | InChI=1S/C19H21NO5/c1-11-15(14-9-7-6-8-10-14)16(18(22)24-4)12(2)20(11)17(13(3)21)19(23)25-5/h6-10,21H,1-5H3/b17-13+ |
| InChIKey | XEOGNCBUMWEMNY-GHRIWEEISA-N |
| XLogP | 3.48 |
| TPSA | 77.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.38 |
| LogP ≤ 5 | 3.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|