C14H13NO4S — CID 135083276
methyl (2Z)-2-(2-methoxy-2-oxoethylidene)-4-phenyl-3H-1,3-thiazole-5-carboxylate (PubChem CID 135083276) has the molecular formula C14H13NO4S and a molecular weight of 291.33 g/mol. Its IUPAC name is methyl (2Z)-2-(2-methoxy-2-oxoethylidene)-4-phenyl-3H-1,3-thiazole-5-carboxylate.
| Compound Name | methyl (2Z)-2-(2-methoxy-2-oxoethylidene)-4-phenyl-3H-1,3-thiazole-5-carboxylate |
|---|---|
| PubChem CID | 135083276 |
| Molecular Formula | C14H13NO4S |
| Molecular Weight | 291.33 g/mol |
| Exact Mass | 291.06 |
| IUPAC Name | methyl (2Z)-2-(2-methoxy-2-oxoethylidene)-4-phenyl-3H-1,3-thiazole-5-carboxylate |
| SMILES | COC(=O)/C=C1/NC(c2ccccc2)=C(C(=O)OC)S1 |
| InChI | InChI=1S/C14H13NO4S/c1-18-11(16)8-10-15-12(9-6-4-3-5-7-9)13(20-10)14(17)19-2/h3-8,15H,1-2H3/b10-8- |
| InChIKey | MXHWFQZQGVLEQO-NTMALXAHSA-N |
| XLogP | 1.88 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.33 |
| LogP ≤ 5 | 1.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|