C26H20N2O4 — CID 15514253
dimethyl (Z)-2-(9-cyano-3-methyl-2-phenylazuleno[1,2-c]pyrrol-1-yl)but-2-enedioate (PubChem CID 15514253) has the molecular formula C26H20N2O4 and a molecular weight of 424.46 g/mol. Its IUPAC name is dimethyl (Z)-2-(9-cyano-3-methyl-2-phenylazuleno[1,2-c]pyrrol-1-yl)but-2-enedioate.
| Compound Name | dimethyl (Z)-2-(9-cyano-3-methyl-2-phenylazuleno[1,2-c]pyrrol-1-yl)but-2-enedioate |
|---|---|
| PubChem CID | 15514253 |
| Molecular Formula | C26H20N2O4 |
| Molecular Weight | 424.46 g/mol |
| Exact Mass | 424.14 |
| IUPAC Name | dimethyl (Z)-2-(9-cyano-3-methyl-2-phenylazuleno[1,2-c]pyrrol-1-yl)but-2-enedioate |
| SMILES | COC(=O)/C=C(\C(=O)OC)c1c2c(C#N)c3cccccc-3c2c(C)n1-c1ccccc1 |
| InChI | InChI=1S/C26H20N2O4/c1-16-23-19-13-9-5-8-12-18(19)21(15-27)24(23)25(28(16)17-10-6-4-7-11-17)20(26(30)32-3)14-22(29)31-2/h4-14H,1-3H3/b20-14- |
| InChIKey | IVCDIZCTPUKAKY-ZHZULCJRSA-N |
| XLogP | 4.64 |
| TPSA | 81.32 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.46 |
| LogP ≤ 5 | 4.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|