C16H13NO4S — CID 44598317
dimethyl (Z)-2-pyrrolo[2,1-b][1,3]benzothiazol-1-ylbut-2-enedioate (PubChem CID 44598317) has the molecular formula C16H13NO4S and a molecular weight of 315.35 g/mol. Its IUPAC name is dimethyl (Z)-2-pyrrolo[2,1-b][1,3]benzothiazol-1-ylbut-2-enedioate.
| Compound Name | dimethyl (Z)-2-pyrrolo[2,1-b][1,3]benzothiazol-1-ylbut-2-enedioate |
|---|---|
| PubChem CID | 44598317 |
| Molecular Formula | C16H13NO4S |
| Molecular Weight | 315.35 g/mol |
| Exact Mass | 315.06 |
| IUPAC Name | dimethyl (Z)-2-pyrrolo[2,1-b][1,3]benzothiazol-1-ylbut-2-enedioate |
| SMILES | COC(=O)/C=C(\C(=O)OC)c1ccc2sc3ccccc3n12 |
| InChI | InChI=1S/C16H13NO4S/c1-20-15(18)9-10(16(19)21-2)11-7-8-14-17(11)12-5-3-4-6-13(12)22-14/h3-9H,1-2H3/b10-9- |
| InChIKey | UBMWJOSOYINZRQ-KTKRTIGZSA-N |
| XLogP | 2.88 |
| TPSA | 57.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.35 |
| LogP ≤ 5 | 2.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|