C17H13NO6S — CID 102383185
dimethyl (E)-2-(3-amino-4-oxothieno[3,4-c]chromen-1-yl)but-2-enedioate (PubChem CID 102383185) has the molecular formula C17H13NO6S and a molecular weight of 359.36 g/mol. Its IUPAC name is dimethyl (E)-2-(3-amino-4-oxothieno[3,4-c]chromen-1-yl)but-2-enedioate.
| Compound Name | dimethyl (E)-2-(3-amino-4-oxothieno[3,4-c]chromen-1-yl)but-2-enedioate |
|---|---|
| PubChem CID | 102383185 |
| Molecular Formula | C17H13NO6S |
| Molecular Weight | 359.36 g/mol |
| Exact Mass | 359.05 |
| IUPAC Name | dimethyl (E)-2-(3-amino-4-oxothieno[3,4-c]chromen-1-yl)but-2-enedioate |
| SMILES | COC(=O)/C=C(\C(=O)OC)c1sc(N)c2c(=O)oc3ccccc3c12 |
| InChI | InChI=1S/C17H13NO6S/c1-22-11(19)7-9(16(20)23-2)14-12-8-5-3-4-6-10(8)24-17(21)13(12)15(18)25-14/h3-7H,18H2,1-2H3/b9-7- |
| InChIKey | AZXQMXASGVXFDI-CLFYSBASSA-N |
| XLogP | 2.32 |
| TPSA | 108.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.36 |
| LogP ≤ 5 | 2.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|