C24H18N2O6 — CID 135679114
methyl 5-hydroxy-2-methyl-1-(4-nitrophenyl)-4-[(Z)-(2-oxonaphthalen-1-ylidene)methyl]pyrrole-3-carboxylate (PubChem CID 135679114) has the molecular formula C24H18N2O6 and a molecular weight of 430.42 g/mol. Its IUPAC name is methyl 5-hydroxy-2-methyl-1-(4-nitrophenyl)-4-[(Z)-(2-oxonaphthalen-1-ylidene)methyl]pyrrole-3-carboxylate.
| Compound Name | methyl 5-hydroxy-2-methyl-1-(4-nitrophenyl)-4-[(Z)-(2-oxonaphthalen-1-ylidene)methyl]pyrrole-3-carboxylate |
|---|---|
| PubChem CID | 135679114 |
| Molecular Formula | C24H18N2O6 |
| Molecular Weight | 430.42 g/mol |
| Exact Mass | 430.12 |
| IUPAC Name | methyl 5-hydroxy-2-methyl-1-(4-nitrophenyl)-4-[(Z)-(2-oxonaphthalen-1-ylidene)methyl]pyrrole-3-carboxylate |
| SMILES | COC(=O)c1c(/C=C2\C(=O)C=Cc3ccccc32)c(O)n(-c2ccc([N+](=O)[O-])cc2)c1C |
| InChI | InChI=1S/C24H18N2O6/c1-14-22(24(29)32-2)20(13-19-18-6-4-3-5-15(18)7-12-21(19)27)23(28)25(14)16-8-10-17(11-9-16)26(30)31/h3-13,28H,1-2H3/b19-13- |
| InChIKey | BFSMEVITUVKBHH-UYRXBGFRSA-N |
| XLogP | 4.32 |
| TPSA | 111.67 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.42 |
| LogP ≤ 5 | 4.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|