C19H13N3O5S — CID 139787222
methyl 1-amino-4-(4-nitrophenyl)-5-oxothieno[2,3-c]isoquinoline-2-carboxylate (PubChem CID 139787222) has the molecular formula C19H13N3O5S and a molecular weight of 395.40 g/mol. Its IUPAC name is methyl 1-amino-4-(4-nitrophenyl)-5-oxothieno[2,3-c]isoquinoline-2-carboxylate.
| Compound Name | methyl 1-amino-4-(4-nitrophenyl)-5-oxothieno[2,3-c]isoquinoline-2-carboxylate |
|---|---|
| PubChem CID | 139787222 |
| Molecular Formula | C19H13N3O5S |
| Molecular Weight | 395.40 g/mol |
| Exact Mass | 395.06 |
| IUPAC Name | methyl 1-amino-4-(4-nitrophenyl)-5-oxothieno[2,3-c]isoquinoline-2-carboxylate |
| SMILES | COC(=O)c1sc2c(c1N)c1ccccc1c(=O)n2-c1ccc([N+](=O)[O-])cc1 |
| InChI | InChI=1S/C19H13N3O5S/c1-27-19(24)16-15(20)14-12-4-2-3-5-13(12)17(23)21(18(14)28-16)10-6-8-11(9-7-10)22(25)26/h2-9H,20H2,1H3 |
| InChIKey | UGSQSAVSUUQYGH-UHFFFAOYSA-N |
| XLogP | 3.48 |
| TPSA | 117.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.40 |
| LogP ≤ 5 | 3.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|