C18H19ClN2O — CID 135971356
4-methyl-2-(2-phenylethylamino)quinolin-7-ol;hydrochloride (PubChem CID 135971356) has the molecular formula C18H19ClN2O and a molecular weight of 314.82 g/mol. Its IUPAC name is 4-methyl-2-(2-phenylethylamino)quinolin-7-ol;hydrochloride.
| Compound Name | 4-methyl-2-(2-phenylethylamino)quinolin-7-ol;hydrochloride |
|---|---|
| PubChem CID | 135971356 |
| Molecular Formula | C18H19ClN2O |
| Molecular Weight | 314.82 g/mol |
| Exact Mass | 314.12 |
| IUPAC Name | 4-methyl-2-(2-phenylethylamino)quinolin-7-ol;hydrochloride |
| SMILES | Cc1cc(NCCc2ccccc2)nc2cc(O)ccc12.Cl |
| InChI | InChI=1S/C18H18N2O.ClH/c1-13-11-18(19-10-9-14-5-3-2-4-6-14)20-17-12-15(21)7-8-16(13)17;/h2-8,11-12,21H,9-10H2,1H3,(H,19,20);1H |
| InChIKey | FWUDTKWZJZAHGM-UHFFFAOYSA-N |
| XLogP | 4.33 |
| TPSA | 45.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.82 |
| LogP ≤ 5 | 4.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |