C30H37N5O4 — CID 135972580
decyl 4-[2-(5-acetamido-2-hydroxyphenyl)-7-methyl-3H-imidazo[1,5-b][1,2,4]triazol-5-yl]benzoate (PubChem CID 135972580) has the molecular formula C30H37N5O4 and a molecular weight of 531.66 g/mol. Its IUPAC name is decyl 4-[2-(5-acetamido-2-hydroxyphenyl)-7-methyl-3H-imidazo[1,5-b][1,2,4]triazol-5-yl]benzoate.
| Compound Name | decyl 4-[2-(5-acetamido-2-hydroxyphenyl)-7-methyl-3H-imidazo[1,5-b][1,2,4]triazol-5-yl]benzoate |
|---|---|
| PubChem CID | 135972580 |
| Molecular Formula | C30H37N5O4 |
| Molecular Weight | 531.66 g/mol |
| Exact Mass | 531.28 |
| IUPAC Name | decyl 4-[2-(5-acetamido-2-hydroxyphenyl)-7-methyl-3H-imidazo[1,5-b][1,2,4]triazol-5-yl]benzoate |
| SMILES | CCCCCCCCCCOC(=O)c1ccc(-c2nc(C)c3nc(-c4cc(NC(C)=O)ccc4O)[nH]n23)cc1 |
| InChI | InChI=1S/C30H37N5O4/c1-4-5-6-7-8-9-10-11-18-39-30(38)23-14-12-22(13-15-23)29-31-20(2)28-33-27(34-35(28)29)25-19-24(32-21(3)36)16-17-26(25)37/h12-17,19,37H,4-11,18H2,1-3H3,(H,32,36)(H,33,34) |
| InChIKey | UABAOKVQXQWOCU-UHFFFAOYSA-N |
| XLogP | 6.66 |
| TPSA | 121.61 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 531.66 |
| LogP ≤ 5 | 6.66 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydroquinone', 'substructure': 'N/A'} |
|---|