C15H19N3O — CID 135974008
4-tert-butyl-2-(4,6-dimethyl-1,3,5-triazin-2-yl)phenol (PubChem CID 135974008) has the molecular formula C15H19N3O and a molecular weight of 257.34 g/mol. Its IUPAC name is 4-tert-butyl-2-(4,6-dimethyl-1,3,5-triazin-2-yl)phenol.
| Compound Name | 4-tert-butyl-2-(4,6-dimethyl-1,3,5-triazin-2-yl)phenol |
|---|---|
| PubChem CID | 135974008 |
| Molecular Formula | C15H19N3O |
| Molecular Weight | 257.34 g/mol |
| Exact Mass | 257.15 |
| IUPAC Name | 4-tert-butyl-2-(4,6-dimethyl-1,3,5-triazin-2-yl)phenol |
| SMILES | Cc1nc(C)nc(-c2cc(C(C)(C)C)ccc2O)n1 |
| InChI | InChI=1S/C15H19N3O/c1-9-16-10(2)18-14(17-9)12-8-11(15(3,4)5)6-7-13(12)19/h6-8,19H,1-5H3 |
| InChIKey | BWZQLVJQEQFOLU-UHFFFAOYSA-N |
| XLogP | 3.16 |
| TPSA | 58.90 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 257.34 |
| LogP ≤ 5 | 3.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |