C32H39N9O12P2 — CID 135976421
[[(2R,3S,4R)-5-(2-amino-6-oxo-1H-purin-9-yl)-3,4-dihydroxyoxolan-2-yl]methoxy-hydroxyphosphoryl] [1-[5-(1,2-diphenylethylamino)-5-oxopentyl]triazol-4-yl]methyl hydrogen phosphate (PubChem CID 135976421) has the molecular formula C32H39N9O12P2 and a molecular weight of 803.66 g/mol. Its IUPAC name is [[(2R,3S,4R)-5-(2-amino-6-oxo-1H-purin-9-yl)-3,4-dihydroxyoxolan-2-yl]methoxy-hydroxyphosphoryl] [1-[5-(1,2-diphenylethylamino)-5-oxopentyl]triazol-4-yl]methyl hydrogen phosphate.
| Compound Name | [[(2R,3S,4R)-5-(2-amino-6-oxo-1H-purin-9-yl)-3,4-dihydroxyoxolan-2-yl]methoxy-hydroxyphosphoryl] [1-[5-(1,2-diphenylethylamino)-5-oxopentyl]triazol-4-yl]methyl hydrogen phosphate |
|---|---|
| PubChem CID | 135976421 |
| Molecular Formula | C32H39N9O12P2 |
| Molecular Weight | 803.66 g/mol |
| Exact Mass | 803.22 |
| IUPAC Name | [[(2R,3S,4R)-5-(2-amino-6-oxo-1H-purin-9-yl)-3,4-dihydroxyoxolan-2-yl]methoxy-hydroxyphosphoryl] [1-[5-(1,2-diphenylethylamino)-5-oxopentyl]triazol-4-yl]methyl hydrogen phosphate |
| SMILES | Nc1nc2c(ncn2C2O[C@H](COP(=O)(O)OP(=O)(O)OCc3cn(CCCCC(=O)NC(Cc4ccccc4)c4ccccc4)nn3)[C@@H](O)[C@H]2O)c(=O)[nH]1 |
| InChI | InChI=1S/C32H39N9O12P2/c33-32-36-29-26(30(45)37-32)34-19-41(29)31-28(44)27(43)24(52-31)18-51-55(48,49)53-54(46,47)50-17-22-16-40(39-38-22)14-8-7-13-25(42)35-23(21-11-5-2-6-12-21)15-20-9-3-1-4-10-20/h1-6,9-12,16,19,23-24,27-28,31,43-44H,7-8,13-15,17-18H2,(H,35,42)(H,46,47)(H,48,49)(H3,33,36,37,45)/t23?,24-,27-,28-,31?/m1/s1 |
| InChIKey | NGVYRIMOEHAVKQ-NGHMWODESA-N |
| XLogP | 1.63 |
| TPSA | 301.38 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 17 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 55 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 803.66 |
| LogP ≤ 5 | 1.63 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 17 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|