C14H10ClN5O — CID 135976615
4-[(2-chlorophenyl)diazenyl]-5-pyridin-3-yl-1,2-dihydropyrazol-3-one (PubChem CID 135976615) has the molecular formula C14H10ClN5O and a molecular weight of 299.72 g/mol. Its IUPAC name is 4-[(2-chlorophenyl)diazenyl]-5-pyridin-3-yl-1,2-dihydropyrazol-3-one.
| Compound Name | 4-[(2-chlorophenyl)diazenyl]-5-pyridin-3-yl-1,2-dihydropyrazol-3-one |
|---|---|
| PubChem CID | 135976615 |
| Molecular Formula | C14H10ClN5O |
| Molecular Weight | 299.72 g/mol |
| Exact Mass | 299.06 |
| IUPAC Name | 4-[(2-chlorophenyl)diazenyl]-5-pyridin-3-yl-1,2-dihydropyrazol-3-one |
| SMILES | O=c1[nH][nH]c(-c2cccnc2)c1/N=N/c1ccccc1Cl |
| InChI | InChI=1S/C14H10ClN5O/c15-10-5-1-2-6-11(10)17-19-13-12(18-20-14(13)21)9-4-3-7-16-8-9/h1-8H,(H2,18,20,21)/b19-17+ |
| InChIKey | DBLNZDPVDYTIQA-HTXNQAPBSA-N |
| XLogP | 3.83 |
| TPSA | 86.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.72 |
| LogP ≤ 5 | 3.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'} |
|---|