C19H21N5O5S2 — CID 135981007
4-[[6-amino-3,5-dicyano-4-(4-hydroxy-3,5-dimethoxyphenyl)-2-pyridinyl]sulfanyl]butane-1-sulfonamide (PubChem CID 135981007) has the molecular formula C19H21N5O5S2 and a molecular weight of 463.54 g/mol. Its IUPAC name is 4-[[6-amino-3,5-dicyano-4-(4-hydroxy-3,5-dimethoxyphenyl)-2-pyridinyl]sulfanyl]butane-1-sulfonamide.
| Compound Name | 4-[[6-amino-3,5-dicyano-4-(4-hydroxy-3,5-dimethoxyphenyl)-2-pyridinyl]sulfanyl]butane-1-sulfonamide |
|---|---|
| PubChem CID | 135981007 |
| Molecular Formula | C19H21N5O5S2 |
| Molecular Weight | 463.54 g/mol |
| Exact Mass | 463.10 |
| IUPAC Name | 4-[[6-amino-3,5-dicyano-4-(4-hydroxy-3,5-dimethoxyphenyl)-2-pyridinyl]sulfanyl]butane-1-sulfonamide |
| SMILES | COc1cc(-c2c(C#N)c(N)nc(SCCCCS(N)(=O)=O)c2C#N)cc(OC)c1O |
| InChI | InChI=1S/C19H21N5O5S2/c1-28-14-7-11(8-15(29-2)17(14)25)16-12(9-20)18(22)24-19(13(16)10-21)30-5-3-4-6-31(23,26)27/h7-8,25H,3-6H2,1-2H3,(H2,22,24)(H2,23,26,27) |
| InChIKey | ZLLOXTZWRHYUMA-UHFFFAOYSA-N |
| XLogP | 1.96 |
| TPSA | 185.34 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 463.54 |
| LogP ≤ 5 | 1.96 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|