C17H17N5O4S2 — CID 135980930
4-[[6-amino-3,5-dicyano-4-(3,4-dihydroxyphenyl)-2-pyridinyl]sulfanyl]butane-1-sulfonamide (PubChem CID 135980930) has the molecular formula C17H17N5O4S2 and a molecular weight of 419.49 g/mol. Its IUPAC name is 4-[[6-amino-3,5-dicyano-4-(3,4-dihydroxyphenyl)-2-pyridinyl]sulfanyl]butane-1-sulfonamide.
| Compound Name | 4-[[6-amino-3,5-dicyano-4-(3,4-dihydroxyphenyl)-2-pyridinyl]sulfanyl]butane-1-sulfonamide |
|---|---|
| PubChem CID | 135980930 |
| Molecular Formula | C17H17N5O4S2 |
| Molecular Weight | 419.49 g/mol |
| Exact Mass | 419.07 |
| IUPAC Name | 4-[[6-amino-3,5-dicyano-4-(3,4-dihydroxyphenyl)-2-pyridinyl]sulfanyl]butane-1-sulfonamide |
| SMILES | N#Cc1c(N)nc(SCCCCS(N)(=O)=O)c(C#N)c1-c1ccc(O)c(O)c1 |
| InChI | InChI=1S/C17H17N5O4S2/c18-8-11-15(10-3-4-13(23)14(24)7-10)12(9-19)17(22-16(11)20)27-5-1-2-6-28(21,25)26/h3-4,7,23-24H,1-2,5-6H2,(H2,20,22)(H2,21,25,26) |
| InChIKey | ACQMHCOLFDRRQF-UHFFFAOYSA-N |
| XLogP | 1.65 |
| TPSA | 187.11 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.49 |
| LogP ≤ 5 | 1.65 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|