About 2-amino-4-(3,5-dihydroxyphenyl)-6-(3-hydroxypropylsulfanyl)pyridine-3,5-dicarbonitrile
2-amino-4-(3,5-dihydroxyphenyl)-6-(3-hydroxypropylsulfanyl)pyridine-3,5-dicarbonitrile (PubChem CID 58739840) has the molecular formula C16H14N4O3S
and a molecular weight of 342.38 g/mol. Its IUPAC name is 2-amino-4-(3,5-dihydroxyphenyl)-6-(3-hydroxypropylsulfanyl)pyridine-3,5-dicarbonitrile.
Molecular Properties
| Compound Name | 2-amino-4-(3,5-dihydroxyphenyl)-6-(3-hydroxypropylsulfanyl)pyridine-3,5-dicarbonitrile |
| PubChem CID | 58739840 |
| Molecular Formula | C16H14N4O3S |
| Molecular Weight | 342.38 g/mol |
| Exact Mass | 342.08 |
| IUPAC Name | 2-amino-4-(3,5-dihydroxyphenyl)-6-(3-hydroxypropylsulfanyl)pyridine-3,5-dicarbonitrile |
| SMILES | N#Cc1c(N)nc(SCCCO)c(C#N)c1-c1cc(O)cc(O)c1 |
| InChI | InChI=1S/C16H14N4O3S/c17-7-12-14(9-4-10(22)6-11(23)5-9)13(8-18)16(20-15(12)19)24-3-1-2-21/h4-6,21-23H,1-3H2,(H2,19,20) |
| InChIKey | KYJQCXBXOMWBAQ-UHFFFAOYSA-N |
| XLogP | 1.96 |
| TPSA | 147.18 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 342.38 |
| LogP ≤ 5 | 1.96 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 2-amino-4-(3,5-dihydroxyphenyl)-6-(3-hydroxypropylsulfanyl)pyridine-3,5-dicarbonitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-amino-4-(3,5-dihydroxyphenyl)-6-(3-hydroxypropylsulfanyl)pyridine-3,5-dicarbonitrile?
The IUPAC name of 2-amino-4-(3,5-dihydroxyphenyl)-6-(3-hydroxypropylsulfanyl)pyridine-3,5-dicarbonitrile (CID 58739840) is 2-amino-4-(3,5-dihydroxyphenyl)-6-(3-hydroxypropylsulfanyl)pyridine-3,5-dicarbonitrile.
What is the SMILES notation for 2-amino-4-(3,5-dihydroxyphenyl)-6-(3-hydroxypropylsulfanyl)pyridine-3,5-dicarbonitrile?
The canonical SMILES for 2-amino-4-(3,5-dihydroxyphenyl)-6-(3-hydroxypropylsulfanyl)pyridine-3,5-dicarbonitrile is N#Cc1c(N)nc(SCCCO)c(C#N)c1-c1cc(O)cc(O)c1.
What is the InChIKey of 2-amino-4-(3,5-dihydroxyphenyl)-6-(3-hydroxypropylsulfanyl)pyridine-3,5-dicarbonitrile?
The InChIKey is KYJQCXBXOMWBAQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H14N4O3S/c17-7-12-14(9-4-10(22)6-11(23)5-9)13(8-18)16(20-15(12)19)24-3-1-2-21/h4-6,21-23H,1-3H2,(H2,19,20).
What are the key properties of 2-amino-4-(3,5-dihydroxyphenyl)-6-(3-hydroxypropylsulfanyl)pyridine-3,5-dicarbonitrile?
2-amino-4-(3,5-dihydroxyphenyl)-6-(3-hydroxypropylsulfanyl)pyridine-3,5-dicarbonitrile has a molecular weight of 342.38 g/mol, XLogP of 1.96, 5 rotatable bonds, 4 hydrogen bond donors, and 8 hydrogen bond acceptors.
Where does this data come from?
All data for 2-amino-4-(3,5-dihydroxyphenyl)-6-(3-hydroxypropylsulfanyl)pyridine-3,5-dicarbonitrile is sourced from PubChem (CID 58739840), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).